Product description of Citicoline raw material:
Citicoline(C14H26N4O11P2) |
|
CAS NO. |
987-78-0 |
Appearance |
White powder |
Assay |
≥98.0% |
Loss on drying |
Not more than 6% |
Heavy Metal |
Not more than 5ppm |
Application |
Raw material、medicine |
Shelf Life |
24 months when properly stored. |
Main mechanism:
Promote the synthesis of lecithin through choline phosphotransferase, improve brain lipid, brain protein and glucose metabolism; it can also increase the respiratory function of mitochondria; at the same time, it can also reduce cerebrovascular resistance, increase brain tissue blood perfusion, and relieve cerebral vascular Paralysis and cerebral edema can also promote the awakening of brain tissue by promoting the ascending reticular activation system of the brainstem reticular structure.
Effect:
1. It can inhibit the decomposition of phospholipids, improve the respiratory function of mitochondria, improve the oxygen uptake capacity of brain cells, thereby reducing cell apoptosis;
2. It can eliminate the inhibition of brain hypoxia on brain protein synthesis, promote the synthesis of acetylcholine from glucose, reduce cerebrovascular resistance, increase cerebral blood flow, and reduce cerebral vascular paralysis and cerebral edema.
3. It can inhibit the generation of oxygen free radicals and peroxides, increase cerebral blood perfusion, improve cerebral blood circulation, and then promote the metabolism of intracranial nutrients and slow down the progress of necrotic lesions.
Reviews
There are no reviews yet.